| Catalog Number |
ACM123359411 |
| CAS |
123359-41-1 |
| Synonyms |
Octylphenylpolyethylene glycol |
| IUPAC Name |
2-[2-[2-[2-[2-[2-[2-[2-[2-[4-(2,5,5-Trimethylhexan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol;2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[4-(2,5,5-trimethylhexan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| Molecular Weight |
1289.8 |
| Molecular Formula |
C68H136O21 |
| Canonical SMILES |
CC(C)(C)CCC(C)(C)C1CCC(CC1)OCCOCCOCCOCCOCCOCCOCCOCCOCCO.CC(C)(C)CCC(C)(C)C1CCC(CC1)OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| InChI |
InChI=1S/C35H70O11.C33H66O10/c1-34(2,3)10-11-35(4,5)32-6-8-33(9-7-32)46-31-30-45-29-28-44-27-26-43-25-24-42-23-22-41-21-20-40-19-18-39-17-16-38-15-14-37-13-12-36;1-32(2,3)10-11-33(4,5)30-6-8-31(9-7-30)43-29-28-42-27-26-41-25-24-40-23-22-39-21-20-38-19-18-37-17-16-36-15-14-35-13-12-34/h32-33,36H,6-31H2,1-5H3;30-31,34H,6-29H2,1-5H3 |
| InChI Key |
FLXVMMNBMSGKSP-UHFFFAOYSA-N |
| Melting Point |
44-46 °C |
| Purity |
98%+ |
| Complexity |
1230 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
1288.95741134 |
| Heavy Atom Count |
89 |
| Hydrogen Bond Acceptor Count |
21 |
| Hydrogen Bond Donor Count |
2 |
| Monoisotopic Mass |
1288.95741134 |
| Rotatable Bond Count |
65 |
| Topological Polar Surface Area |
216 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.