| Catalog Number |
ACM1338392-2 |
| CAS |
1338-39-2 |
| Structure |  |
| Synonyms |
Arlasel 20 |
| IUPAC Name |
[2-[(2R,3R,4S)-3,4-Dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate |
| Molecular Weight |
346.5 |
| Molecular Formula |
C18H34O6 |
| Canonical SMILES |
CCCCCCCCCCCC(=O)OCC(C1C(C(CO1)O)O)O |
| InChI |
InChI=1S/C18H34O6/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-13-15(20)18-17(22)14(19)12-24-18/h14-15,17-20,22H,2-13H2,1H3/t14-,15?,17+,18+/m0/s1 |
| InChI Key |
LWZFANDGMFTDAV-WYDSMHRWSA-N |
| Purity |
99% |
| Complexity |
336 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
3 |
| Exact Mass |
346.2355388 |
| Heavy Atom Count |
24 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
CCCCCCCCCCCC(=O)OCC([C@@H]1[C@@H]([C@H](CO1)O)O)O |
| Monoisotopic Mass |
346.2355388 |
| Physical State |
Liquid |
| Rotatable Bond Count |
14 |
| Topological Polar Surface Area |
96.2 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.