| Catalog Number |
ACM139888-1 |
| CAS |
139-88-8 |
| Synonyms |
7-Ethyl-2-methyl-4-undecanol (sulfuric acid sodium) salt |
| IUPAC Name |
Sodium;(7-ethyl-2-methylundecan-4-yl) sulfate |
| Molecular Weight |
316.43 |
| Molecular Formula |
C14H29NaO4S |
| Canonical SMILES |
CCCCC(CC)CCC(CC(C)C)OS(=O)(=O)[O-].[Na+] |
| InChI |
InChI=1S/C14H30O4S.Na/c1-5-7-8-13(6-2)9-10-14(11-12(3)4)18-19(15,16)17;/h12-14H,5-11H2,1-4H3,(H,15,16,17);/q;+1/p-1 |
| InChI Key |
FVEFRICMTUKAML-UHFFFAOYSA-M |
| Purity |
95%+ |
| Complexity |
312 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
316.16842486 |
| Heavy Atom Count |
20 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
0 |
| Monoisotopic Mass |
316.16842486 |
| Rotatable Bond Count |
11 |
| Topological Polar Surface Area |
74.8 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.