Catalog Number |
ACM1338438-2 |
CAS |
1338-43-8 |
Structure |
 |
Description |
Sorbitan Monooleate is a synthetic compound that is derived from sorbitol, a sugar alcohol. Sorbitan Monooleate acts as a surfactant, which means it helps to stabilize mixtures of water and oil. Sorbitan Monooleate is also used in the cosmetic industry as an emulsifier and thickener in various creams, lotions, and other personal care products. |
Synonyms |
1,4-Anhydro-6-O-[(9Z)-Octadec-9-Enoyl]-D-Glucitol |
IUPAC Name |
[(2R)-2-[(2R,3R,4S)-3,4-Dihydroxyoxolan-2-yl]-2-hydroxyethyl] (Z)-octadec-9-enoate |
Molecular Weight |
428.60 |
Molecular Formula |
C24H44O6 |
Canonical SMILES |
CCCCCCCC/C=C\\CCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
InChI |
InChI=1S/C24H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3/b10-9-/t20-,21+,23+,24+/m0/s1 |
InChI Key |
NWGKJDSIEKMTRX-AAZCQSIUSA-N |
Boiling Point |
>260 °C |
Purity |
99%+ |
Appearance |
yellowish-brown oily liquid or a waxy solid at room temperature |
Application |
1. Emulsifier: Sorbitan Monooleate is commonly used as an emulsifier in food and skincare products. 2. Surfactant: It acts as a surfactant, which means it lowers the surface tension between two substances, allowing them to mix together. 3. Stabilizer: This ingredient helps to stabilize emulsions and prevent separation of oil and water-based ingredients. 4. Thickener: Sorbitan Monooleate is used as a thickener in some personal care products such as shampoos and conditioners. 5. Solubilizer: It can help to dissolve oils and other hydrophobic ingredients in water-based formulations, making it easier to create homogeneous products. 6. Anti-foaming agent: It is also used as an anti-foaming agent to prevent excessive foaming in food and cosmetic products. 7. Mold release agent: In the plastic and rubber industry, Sorbitan Monooleate is used as a mold release agent, preventing substances from sticking to molds. |
Complexity |
453 |
Covalently-Bonded Unit Count |
1 |
Defined Atom Stereocenter Count |
4 |
Exact Mass |
428.31378912 |
Heavy Atom Count |
30 |
Hydrogen Bond Acceptor Count |
6 |
Hydrogen Bond Donor Count |
3 |
Isomeric SMILES |
CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]([C@@H]1[C@@H]([C@H](CO1)O)O)O |
Monoisotopic Mass |
428.31378912 |
Physical State |
Liquid |
Rotatable Bond Count |
19 |
Topological Polar Surface Area |
96.2 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.