What is the IUPAC name of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The IUPAC name of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is sodium;[(2R)-2,3-di(hexanoyloxy)propyl] hydrogen phosphate.
What is the molecular formula of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The molecular formula of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is C15H28NaO8P.
What is the exact mass of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The exact mass of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is 390.14194913.
How many hydrogen bond acceptors does Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate have?
Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate has 8 hydrogen bond acceptors.
What is the CAS number of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The CAS number of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is 321883-53-8.
How many heavy atoms does Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate contain?
Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate contains 25 heavy atoms.
What is the canonical SMILES representation of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The canonical SMILES representation of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is CCCCCC(=O)OCC(COP(=O)(O)[O-])OC(=O)CCCCC.[Na+]
How many rotatable bonds are present in Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate has 16 rotatable bonds.
What is the computed properties complexity of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The computed properties complexity of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is 418.
What is the InChIKey of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate?
The InChIKey of Sodium (2R)-2,3-bis(hexanoyloxy)propyl hydrogen phosphate is RSKVQVAHZSAALH-BTQNPOSSSA-M.