What is the molecular formula of saponin?
The molecular formula of saponin is C58H94O27.
What are some synonyms for saponin?
Some synonyms for saponin include sapogenins, glycosides, and NSC 104795.
What is the molecular weight of saponin?
The molecular weight of saponin is 1223.3 g/mol.
What is the description of saponin?
Saponin is a natural product found in various plants, consisting of a sapogenin as the aglycone moiety and a sugar.
What is the IUPAC name of saponin?
The IUPAC name of saponin is (2R,4S,5R,10S,13R,14R,18S,20R)-10-[(2S,3R,4S,5S)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-24-oxahexacyclo[15.5.2.0 1,18 .0 4,17 .0 5,14 .0 8,13 ]tetracosane-20-carbaldehyde.
What is the InChIKey of saponin?
The InChIKey of saponin is MAEBCGDGGATMSC-OSHGGGOQSA-N.
What is the canonical SMILES of saponin?
The canonical SMILES of saponin is CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(CO5)O)O)O)OC6C(C(C(C(O6)CO)O)O)O)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CCC91C3(CC(C2(C9CC(CC2)(C)C=O)CO1)O)C)C)C.
What is the CAS number for saponin?
The CAS number for saponin is 23643-76-7.
How many hydrogen bond donor counts does saponin have?
Saponin has 15 hydrogen bond donor counts.
What is the XLogP3-AA value of saponin?
The XLogP3-AA value of saponin is -2.7.