| Catalog Number |
ACM61791126 |
| CAS |
61791-12-6 |
| Synonyms |
Cremophor EL |
| IUPAC Name |
2-[1,3-Bis[2-[(Z)-11-hydroxyheptadec-8-enoxy]carbonyloxyethoxy]propan-2-yloxy]ethyl [(Z)-11-hydroxyheptadec-8-enyl] carbonate |
| Molecular Weight |
1113.6 |
| Molecular Formula |
C63H116O15 |
| Canonical SMILES |
CCCCCCC(CC=CCCCCCCCOC(=O)OCCOCC(COCCOC(=O)OCCCCCCCC=CCC(CCCCCC)O)OCCOC(=O)OCCCCCCCC=CCC(CCCCCC)O)O |
| InChI |
InChI=1S/C63H116O15/c1-4-7-10-31-40-57(64)43-34-25-19-13-16-22-28-37-46-73-61(67)76-51-49-70-55-60(72-53-54-78-63(69)75-48-39-30-24-18-15-21-27-36-45-59(66)42-33-12-9-6-3)56-71-50-52-77-62(68)74-47-38-29-23-17-14-20-26-35-44-58(65)41-32-11-8-5-2/h25-27,34-36,57-60,64-66H,4-24,28-33,37-56H2,1-3H3/b34-25-,35-26-,36-27- |
| InChI Key |
LXZHFNATOMRESM-AAKVHIHISA-N |
| Complexity |
1310 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
1112.83142299 |
| Heavy Atom Count |
78 |
| Hydrogen Bond Acceptor Count |
15 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
CCCCCCC(O)C/C=C\CCCCCCCOC(=O)OCCOCC(OCCOC(=O)OCCCCCCC/C=C\CC(O)CCCCCC)COCCOC(=O)OCCCCCCC/C=C\CC(O)CCCCCC |
| Monoisotopic Mass |
1112.83142299 |
| Physical State |
Viscous liquid |
| Rotatable Bond Count |
65 |
| Topological Polar Surface Area |
195 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.