| Catalog Number |
ACM9005703-1 |
| CAS |
9005-70-3 |
| Synonyms |
PEG Sorbitan trioleate |
| IUPAC Name |
Methyl 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)thiophene-2-carboxylate |
| Molecular Weight |
355.4 |
| Molecular Formula |
C14H13NO6S2 |
| Canonical SMILES |
COC(=O)C1=C(C=CS1)S(=O)(=O)NCC2=CC3=C(C=C2)OCO3 |
| InChI |
KPCLPBLTPXDOIR-UHFFFAOYSA-N |
| InChI Key |
InChI=1S/C14H13NO6S2/c1-19-14(16)13-12(4-5-22-13)23(17,18)15-7-9-2-3-10-11(6-9)21-8-20-10/h2-6,15H,7-8H2,1H3 |
| Boiling Point |
100 °C |
| Melting Point |
-20 °C |
| Purity |
99% |
| Density |
1.028g/ml |
| Complexity |
534 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
355.01842948 |
| Heavy Atom Count |
23 |
| Hydrogen Bond Acceptor Count |
8 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
355.01842948 |
| Physical State |
Liquid/Paste/Solid |
| Rotatable Bond Count |
6 |
| Topological Polar Surface Area |
128 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.