| Catalog Number |
ACM54549234-1 |
| CAS |
54549-23-4 |
| Synonyms |
D-Glucoside, octyl |
| IUPAC Name |
(2R,3S,4S,5R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
| Molecular Weight |
292.37 |
| Molecular Formula |
C14H28O6 |
| Canonical SMILES |
CCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| InChI |
InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-19-14-13(18)12(17)11(16)10(9-15)20-14/h10-18H,2-9H2,1H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChI Key |
HEGSGKPQLMEBJL-RQICVUQASA-N |
| Boiling Point |
454.11 °C at 760 mmHg (Predicted) |
| Melting Point |
168.72 °C (Predicted) |
| Purity |
≥98% |
| Density |
1.19 g/cm3(Predicted) |
| Appearance |
White to off-white powder |
| Complexity |
250 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
4 |
| EC Number |
259-216-0 |
| Exact Mass |
292.18858861 |
| Heavy Atom Count |
20 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| MDL Number |
MFCD00066073 |
| Monoisotopic Mass |
292.18858861 |
| Physical State |
Solid |
| Rotatable Bond Count |
9 |
| Topological Polar Surface Area |
99.4 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.