| Catalog Number |
ACM10248745-1 |
| CAS |
10248-74-5 |
| Structure |  |
| Synonyms |
2-(Bis(2-hydroxyethyl)amino)ethyl stearate |
| IUPAC Name |
2-[Bis(2-hydroxyethyl)amino]ethyl octadecanoate |
| Molecular Weight |
415.6 |
| Molecular Formula |
C24H49NO4 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCC(=O)OCCN(CCO)CCO |
| InChI |
InChI=1S/C24H49NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(28)29-23-20-25(18-21-26)19-22-27/h26-27H,2-23H2,1H3 |
| InChI Key |
FVIMRJIDRHUTQP-UHFFFAOYSA-N |
| Purity |
95%+ |
| Complexity |
333 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
415.36615904 |
| Heavy Atom Count |
29 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
2 |
| Monoisotopic Mass |
415.36615904 |
| Physical State |
Liquid |
| Rotatable Bond Count |
24 |
| Topological Polar Surface Area |
70 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.