| Catalog Number |
ACM869653907 |
| CAS |
869653-90-7 |
| Structure |  |
| Synonyms |
HEGA-9 |
| IUPAC Name |
N-(2-hydroxyethyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]nonanamide |
| Molecular Weight |
365.46 |
| Molecular Formula |
C17H35NO7 |
| Canonical SMILES |
CCCCCCCCC(=O)N(CCO)CC(C(C(C(CO)O)O)O)O |
| InChI |
InChI=1S/C17H35NO7/c1-2-3-4-5-6-7-8-15(23)18(9-10-19)11-13(21)16(24)17(25)14(22)12-20/h13-14,16-17,19-22,24-25H,2-12H2,1H3/t13-,14+,16+,17+/m0/s1 |
| InChI Key |
REPLXGVUTGZQCG-XOSAIJSUSA-N |
| Purity |
≥98% |
| Solubility |
≥20% (in water at 0-5 °C) |
| Appearance |
White to off-white solid |
| Complexity |
343 |
| Covalently-Bonded Unit Count |
1 |
| Critical Micelle Concentration |
(H₂O) ~ 39 mM (1.4%) |
| Defined Atom Stereocenter Count |
4 |
| Exact Mass |
365.24135246 |
| Heavy Atom Count |
25 |
| Hydrogen Bond Acceptor Count |
7 |
| Hydrogen Bond Donor Count |
6 |
| Isomeric SMILES |
CCCCCCCCC(=O)N(CCO)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Monoisotopic Mass |
365.24135246 |
| pH |
5-8 (1% solution in water) |
| Rotatable Bond Count |
15 |
| Topological Polar Surface Area |
142 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.