| Catalog Number |
ACM464926032 |
| CAS |
464926-03-2 |
| Structure |  |
| Synonyms |
N1,N1,N4-Tris(3-ammoniopropyl)-5-((2-(3,4-bis((Z)-octadec-9-en-1-yloxy)benzamido)ethyl)amino)-5-oxopentane-1,4-diaminium chloride |
| IUPAC Name |
N-[2-[[(2S)-2-(3-aminopropylamino)-5-[bis(3-aminopropyl)amino]pentanoyl]amino]ethyl]-3,4-bis[(Z)-octadec-9-enoxy]benzamide;pentahydrochloride |
| Molecular Weight |
1164.86 |
| Molecular Formula |
C59H116Cl5N7O4 |
| Canonical SMILES |
CCCCCCCC/C=C\CCCCCCCCOC1=C(C=C(C=C1)C(=O)NCCNC(=O)[C@H](CCCN(CCCN)CCCN)NCCCN)OCCCCCCCC/C=C\CCCCCCCC.Cl.Cl.Cl.Cl.Cl |
| InChI |
XUWJOLKERZXVGQ-XAGHHNLJSA-N |
| InChI Key |
InChI=1S/C59H111N7O4.5ClH/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-51-69-56-41-40-54(53-57(56)70-52-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)58(67)64-46-47-65-59(68)55(63-45-36-42-60)39-35-48-66(49-37-43-61)50-38-44-62;;;;;/h17-20,40-41,53,55,63H,3-16,21-39,42-52,60-62H2,1-2H3,(H,64,67)(H,65,68);5*1H/b19-17-,20-18-;;;;;/t55-;;;;;/m0...../s1 |
| Purity |
>99% |
| Appearance |
Powder |
| Complexity |
1180 |
| Covalently-Bonded Unit Count |
6 |
| Defined Atom Stereocenter Count |
1 |
| Exact Mass |
1161.754 |
| Heavy Atom Count |
75 |
| Hydrogen Bond Acceptor Count |
9 |
| Hydrogen Bond Donor Count |
11 |
| Hygroscopic |
No |
| Isomeric SMILES |
CCCCCCCC/C=C\CCCCCCCCOC1=C(C=C(C=C1)C(=O)NCCNC(=O)[C@H](CCCN(CCCN)CCCN)NCCCN)OCCCCCCCC/C=C\CCCCCCCC.Cl.Cl.Cl.Cl.Cl |
| Light Sensitive |
No |
| Monoisotopic Mass |
1161.753144 |
| Percent Composition |
C 60.83%, H 10.04%, Cl 15.22%, N 8.42%, O 5.49% |
| Rotatable Bond Count |
53 |
| Stability |
1 Year |
| Storage Conditions |
-20 °C |
| Storage Temperature |
-20 °C |
| Topological Polar Surface Area |
170 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.