| Catalog Number |
ACM15178764-1 |
| CAS |
15178-76-4 |
| Structure |  |
| Synonyms |
3-(Dimethyl-octylazaniumyl)propane-1-sulfonate |
| Molecular Weight |
279.44 |
| Molecular Formula |
C13H29NO3S |
| Canonical SMILES |
CCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI |
InChI=1S/C13H29NO3S/c1-4-5-6-7-8-9-11-14(2,3)12-10-13-18(15,16)17/h4-13H2,1-3H3 |
| InChI Key |
QZRAABPTWGFNIU-UHFFFAOYSA-N |
| Melting Point |
212-215 °C |
| Purity |
98% |
| Complexity |
281 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
279.18681496 |
| Heavy Atom Count |
18 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
0 |
| Monoisotopic Mass |
279.18681496 |
| Physical State |
Solid |
| Rotatable Bond Count |
10 |
| Topological Polar Surface Area |
65.6 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.