| Catalog Number |
ACM97789-1 |
| CAS |
97-78-9 |
| Synonyms |
N-Dodecanoylsarcosine |
| IUPAC Name |
2-[dodecanoyl(methyl)amino]acetic acid |
| Molecular Weight |
271.40 |
| Molecular Formula |
C15H29NO3 |
| Canonical SMILES |
CCCCCCCCCCCC(=O)N(C)CC(=O)O |
| InChI |
InChI=1S/C15H29NO3/c1-3-4-5-6-7-8-9-10-11-12-14(17)16(2)13-15(18)19/h3-13H2,1-2H3,(H,18,19) |
| InChI Key |
BACYUWVYYTXETD-UHFFFAOYSA-N |
| Boiling Point |
413.2±28.0 °C (Predicted) |
| Melting Point |
45-50 °C |
| Flash Point |
203.7°C |
| Purity |
90%+ |
| Density |
0.98 g/cm³ |
| Solubility |
Soluble in methanol, insoluble in water. |
| Appearance |
Solid |
| Complexity |
254 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| EC Number |
202-608-3 |
| Exact Mass |
271.21474379 |
| Grade |
PHARM |
| Heavy Atom Count |
19 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
1 |
| Isomeric SMILES |
CCCCCCCCCCCC(=O)N(C)CC(=O)O |
| MDL Number |
MFCD00021749 |
| Monoisotopic Mass |
271.21474379 |
| Rotatable Bond Count |
12 |
| Storage Conditions |
Room temperature |
| Topological Polar Surface Area |
57.6 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.