| Catalog Number |
ACM15163367 |
| CAS |
15163-36-7 |
| Structure |  |
| Synonyms |
3-(Decyldimethylazaniumyl)propane-1-sulfonate |
| Molecular Weight |
307.5 |
| Molecular Formula |
C15H33NO3S |
| Canonical SMILES |
CCCCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| InChI |
InChI=1S/C15H33NO3S/c1-4-5-6-7-8-9-10-11-13-16(2,3)14-12-15-20(17,18)19/h4-15H2,1-3H3 |
| InChI Key |
WKALLSVICJPZTM-UHFFFAOYSA-N |
| Melting Point |
221-224 °C |
| Purity |
99% |
| Complexity |
307 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
307.21811509 |
| Heavy Atom Count |
20 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
0 |
| Monoisotopic Mass |
307.21811509 |
| Physical State |
Solid |
| Rotatable Bond Count |
12 |
| Topological Polar Surface Area |
65.6 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.