| Catalog Number |
ACM85618195-1 |
| CAS |
85618-19-5 |
| Synonyms |
Nonyl 2-acetamido-2-deoxy-β-D-glucopyranoside |
| IUPAC Name |
(2S,3R,4S,5S,6R)-2-Hexylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
280.38 |
| Molecular Formula |
C12H24O5S |
| Canonical SMILES |
CCCCCCSC1C(C(C(C(O1)CO)O)O)O |
| InChI |
InChI=1S/C12H24O5S/c1-2-3-4-5-6-18-12-11(16)10(15)9(14)8(7-13)17-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11-,12+/m1/s1 |
| InChI Key |
ATFNYTMEOCLMPS-ZIQFBCGOSA-N |
| Melting Point |
56-58 °C |
| Purity |
95%+ |
| Complexity |
229 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
5 |
| Exact Mass |
280.13444504 |
| Heavy Atom Count |
18 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CCCCCCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Monoisotopic Mass |
280.13444504 |
| Rotatable Bond Count |
7 |
| Topological Polar Surface Area |
115 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.