| Catalog Number |
ACM85618208-1 |
| CAS |
85618-20-8 |
| Structure |  |
| Synonyms |
N-heptyl β-d-thioglucopyranoside |
| IUPAC Name |
(2S,3R,4S,5S,6R)-2-Heptylsulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
294.41 |
| Molecular Formula |
C13H26O5S |
| Canonical SMILES |
CCCCCCCSC1C(C(C(C(O1)CO)O)O)O |
| InChI |
InChI=1S/C13H26O5S/c1-2-3-4-5-6-7-19-13-12(17)11(16)10(15)9(8-14)18-13/h9-17H,2-8H2,1H3/t9-,10-,11+,12-,13+/m1/s1 |
| InChI Key |
HPEGNLMTTNTJSP-LBELIVKGSA-N |
| Melting Point |
96.1-98.3 °C |
| Purity |
98%+ |
| Complexity |
241 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
5 |
| Exact Mass |
294.1500951 |
| Heavy Atom Count |
19 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CCCCCCCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Monoisotopic Mass |
294.1500951 |
| Rotatable Bond Count |
8 |
| Topological Polar Surface Area |
115 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.