| Catalog Number |
ACM142187-1 |
| CAS |
142-18-7 |
| Structure |  |
| Synonyms |
Glycerin 1-monolaurate |
| IUPAC Name |
2,3-Dihydroxypropyl dodecanoate |
| Molecular Weight |
274.4 |
| Molecular Formula |
C15H30O4 |
| Canonical SMILES |
CCCCCCCCCCCC(=O)OCC(CO)O |
| InChI |
InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3 |
| InChI Key |
ARIWANIATODDMH-UHFFFAOYSA-N |
| Melting Point |
63 °C |
| Purity |
98%+ |
| Complexity |
206 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
274.21440943 |
| Heavy Atom Count |
19 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
2 |
| Monoisotopic Mass |
274.21440943 |
| Physical State |
Powder |
| Rotatable Bond Count |
14 |
| Topological Polar Surface Area |
66.8 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.