| Catalog Number |
ACM67425 |
| CAS |
67-42-5 |
| Synonyms |
1,2-Bis(2-dicarboxymethylaminoethoxy)ethane |
| IUPAC Name |
2-[2-[2-[2-[Bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| Molecular Weight |
380.35 |
| Molecular Formula |
C14H24N2O10 |
| Canonical SMILES |
C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| InChI |
InChI=1S/C14H24N2O10/c17-11(18)7-15(8-12(19)20)1-3-25-5-6-26-4-2-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChI Key |
DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Melting Point |
241 °C |
| Purity |
98%+ |
| Complexity |
397 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
380.14309497 |
| Heavy Atom Count |
26 |
| Hydrogen Bond Acceptor Count |
12 |
| Hydrogen Bond Donor Count |
4 |
| Monoisotopic Mass |
380.14309497 |
| Physical State |
Crystalline powder |
| Rotatable Bond Count |
17 |
| Topological Polar Surface Area |
174 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.