| Catalog Number |
ACM9004993-2 |
| CAS |
9004-99-3 |
| Synonyms |
Polyoxyethylene stearate |
| IUPAC Name |
2-Hydroxyethyl octadecanoate |
| Molecular Weight |
328.5 |
| Molecular Formula |
C20H40O3 |
| Canonical SMILES |
CCCCCCCCCCCCCCCCCC(=O)OCCO |
| InChI |
InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
| InChI Key |
RFVNOJDQRGSOEL-UHFFFAOYSA-N |
| Melting Point |
47 °C |
| Complexity |
241 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
328.29774513 |
| Heavy Atom Count |
23 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
328.29774513 |
| Rotatable Bond Count |
19 |
| Topological Polar Surface Area |
46.5 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.