| Catalog Number |
ACM10108879-1 |
| CAS |
10108-87-9 |
| Structure |  |
| Synonyms |
N,N,N-Trimethyldecan-1-aminium chloride |
| IUPAC Name |
Decyl(trimethyl)azanium;chloride |
| Molecular Weight |
235.84 |
| Molecular Formula |
C13H30ClN |
| Canonical SMILES |
CCCCCCCCCC[N+](C)(C)C.[Cl-] |
| InChI |
InChI=1S/C13H30N.ClH/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChI Key |
HXWGXXDEYMNGCT-UHFFFAOYSA-M |
| Melting Point |
>180 °C |
| Purity |
99% |
| Solubility |
Slightly soluble in chloroform and methanol |
| Appearance |
White powder |
| Storage |
Sealed in dry, Room Temperature |
| Complexity |
113 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
0 |
| EC Number |
233-299-3 |
| Exact Mass |
98.059246208 |
| Heavy Atom Count |
15 |
| Hydrogen Bond Acceptor Count |
1 |
| Hydrogen Bond Donor Count |
0 |
| Monoisotopic Mass |
98.059246208 |
| Physical State |
Solid/Paste/Liquid |
| Rotatable Bond Count |
9 |
| Topological Polar Surface Area |
67.6 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.