| Catalog Number |
ACM148565564-1 |
| CAS |
148565-56-4 |
| Structure |  |
| Synonyms |
Decyl-β-d-1-thiomaltopyranoside |
| IUPAC Name |
(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-6-Decylsulfanyl-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
498.6 |
| Molecular Formula |
C22H42O10S |
| Canonical SMILES |
CCCCCCCCCCSC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |
| InChI |
InChI=1S/C22H42O10S/c1-2-3-4-5-6-7-8-9-10-33-22-19(29)17(27)20(14(12-24)31-22)32-21-18(28)16(26)15(25)13(11-23)30-21/h13-29H,2-12H2,1H3/t13-,14-,15-,16+,17-,18-,19-,20-,21-,22+/m1/s1 |
| InChI Key |
YZNNXXWNKQOETJ-HYLFJBCQSA-N |
| Purity |
95%+ |
| Complexity |
529 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
10 |
| Exact Mass |
498.24986871 |
| Heavy Atom Count |
33 |
| Hydrogen Bond Acceptor Count |
11 |
| Hydrogen Bond Donor Count |
7 |
| Isomeric SMILES |
CCCCCCCCCCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
| Monoisotopic Mass |
498.24986871 |
| Rotatable Bond Count |
14 |
| Topological Polar Surface Area |
195 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.