| Catalog Number |
ACM864434140 |
| CAS |
864434-14-0 |
| Synonyms |
C-HEGA-9 |
| IUPAC Name |
3-cyclohexyl-N-(2-hydroxyethyl)-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| Molecular Weight |
363.45 |
| Molecular Formula |
C17H33NO7 |
| Canonical SMILES |
C1CCC(CC1)CCC(=O)N(CCO)CC(C(C(C(CO)O)O)O)O |
| InChI |
InChI=1S/C17H33NO7/c19-9-8-18(10-13(21)16(24)17(25)14(22)11-20)15(23)7-6-12-4-2-1-3-5-12/h12-14,16-17,19-22,24-25H,1-11H2/t13-,14+,16+,17+/m0/s1 |
| InChI Key |
AHJZPLOICPCLQM-XOSAIJSUSA-N |
| Purity |
≥99% |
| Solubility |
≥20% (in water at 20 °C) |
| Appearance |
White to off-white powder |
| Complexity |
376 |
| Covalently-Bonded Unit Count |
1 |
| Critical Micelle Concentration |
(H₂O) ~ 108 mM (3.9%) |
| Defined Atom Stereocenter Count |
4 |
| Exact Mass |
363.22570239 |
| Heavy Atom Count |
25 |
| Hydrogen Bond Acceptor Count |
7 |
| Hydrogen Bond Donor Count |
6 |
| Isomeric SMILES |
C1CCC(CC1)CCC(=O)N(CCO)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Monoisotopic Mass |
363.22570239 |
| pH |
5-8 (1% solution in water) |
| Rotatable Bond Count |
11 |
| Topological Polar Surface Area |
142 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.