| Catalog Number |
ACM115457835-1 |
| CAS |
115457-83-5 |
| Synonyms |
Methyl-6-O-(N-heptylcarbamoyl)-alpha-D-glucopyranoside |
| IUPAC Name |
[(2R,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate |
| Molecular Weight |
335.39 |
| Molecular Formula |
C15H29NO7 |
| Canonical SMILES |
CCCCCCCNC(=O)OCC1C(C(C(C(O1)OC)O)O)O |
| InChI |
InChI=1S/C15H29NO7/c1-3-4-5-6-7-8-16-15(20)22-9-10-11(17)12(18)13(19)14(21-2)23-10/h10-14,17-19H,3-9H2,1-2H3,(H,16,20)/t10-,11-,12+,13-,14+/m1/s1 |
| InChI Key |
XPIVOYOQXKNYHA-RGDJUOJXSA-N |
| Melting Point |
103-105 °C |
| Purity |
98%+ |
| Complexity |
342 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
5 |
| Exact Mass |
335.19440226 |
| Heavy Atom Count |
23 |
| Hydrogen Bond Acceptor Count |
7 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CCCCCCCNC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC)O)O)O |
| Monoisotopic Mass |
335.19440226 |
| Physical State |
Powder |
| Rotatable Bond Count |
10 |
| Topological Polar Surface Area |
118 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.