| Catalog Number |
ACM15471177-2 |
| CAS |
15471-17-7 |
| Structure |  |
| Synonyms |
1-Pyridiniumpropane-1-sulfonate |
| IUPAC Name |
3-Pyridin-1-ium-1-ylpropane-1-sulfonate |
| Molecular Weight |
201.25 |
| Molecular Formula |
C8H11NO3S |
| Canonical SMILES |
C1=CC=[N+](C=C1)CCCS(=O)(=O)[O-] |
| InChI |
InChI=1S/C8H11NO3S/c10-13(11,12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChI Key |
REEBJQTUIJTGAL-UHFFFAOYSA-N |
| Melting Point |
275-277 °C |
| Purity |
99%+ |
| Solubility |
Soluble in water |
| Appearance |
Powder |
| Storage |
Sealed in dry, room temperature |
| Complexity |
213 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
201.04596439 |
| Heavy Atom Count |
13 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
0 |
| MDL Number |
MFCD00064468 |
| Monoisotopic Mass |
201.04596439 |
| Physical State |
Powder |
| Rotatable Bond Count |
3 |
| Topological Polar Surface Area |
69.5 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.