| Catalog Number |
ACM9004813-2 |
| CAS |
9004-81-3 |
| Synonyms |
Polyethylene glycol monolaurate |
| IUPAC Name |
2-Hydroxyethyl dodecanoate |
| Molecular Weight |
244.37 |
| Molecular Formula |
C14H28O3 |
| Canonical SMILES |
CCCCCCCCCCCC(=O)OCCO |
| InChI |
InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-14(16)17-13-12-15/h15H,2-13H2,1H3 |
| InChI Key |
CTXGTHVAWRBISV-UHFFFAOYSA-N |
| Boiling Point |
>260 °C |
| Flash Point |
>110°C |
| Purity |
95%+ |
| Density |
0.937 g/cm³ |
| Appearance |
Light amber liquid |
| Complexity |
169 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
244.20384475 |
| Heavy Atom Count |
17 |
| Hydrogen Bond Acceptor Count |
3 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
244.20384475 |
| Rotatable Bond Count |
13 |
| Topological Polar Surface Area |
46.5 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.