| Catalog Number |
ACM1849616427 |
| CAS |
1849616-42-7 |
| Structure |  |
| Synonyms |
Methoxypoly(ethylene glycol) ditetradecylacetamide |
| IUPAC Name |
Azane;2-(2-methoxyethoxy)-N,N-di(tetradecyl)acetamide |
| Molecular Weight |
542.9 |
| Molecular Formula |
C33H70N2O3 |
| Canonical SMILES |
CCCCCCCCCCCCCCN(CCCCCCCCCCCCCC)C(=O)COCCOC.N |
| InChI |
InChI=1S/C33H67NO3.H3N/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-34(33(35)32-37-31-30-36-3)29-27-25-23-21-19-17-15-13-11-9-7-5-2;/h4-32H2,1-3H3;1H3 |
| InChI Key |
XRINHCGBBXKJPI-UHFFFAOYSA-N |
| Purity |
98%+ |
| Complexity |
415 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
542.5386441 |
| Heavy Atom Count |
38 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
542.5386441 |
| Physical State |
Solid |
| Rotatable Bond Count |
31 |
| Storage Conditions |
-20 °C |
| Topological Polar Surface Area |
39.8 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.