| Catalog Number |
ACM148565575 |
| CAS |
148565-57-5 |
| Structure |  |
| Synonyms |
Indolyl -1,3-diacetate |
| IUPAC Name |
(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-4,5-Dihydroxy-2-(hydroxymethyl)-6-undecylsulfanyloxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
512.7 |
| Molecular Formula |
C23H44O10S |
| Canonical SMILES |
CCCCCCCCCCCSC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |
| InChI |
InChI=1S/C23H44O10S/c1-2-3-4-5-6-7-8-9-10-11-34-23-20(30)18(28)21(15(13-25)32-23)33-22-19(29)17(27)16(26)14(12-24)31-22/h14-30H,2-13H2,1H3/t14-,15-,16-,17+,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChI Key |
SQISXDUZDUDUNY-GNKAUAAYSA-N |
| Purity |
98%+ |
| Complexity |
544 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
10 |
| Exact Mass |
512.26551877 |
| Heavy Atom Count |
34 |
| Hydrogen Bond Acceptor Count |
11 |
| Hydrogen Bond Donor Count |
7 |
| Isomeric SMILES |
CCCCCCCCCCCS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
| Monoisotopic Mass |
512.26551877 |
| Physical State |
Solid |
| Rotatable Bond Count |
15 |
| Topological Polar Surface Area |
195 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.