| Catalog Number |
ACM9002931-3 |
| CAS |
9002-93-1 |
| Structure |  |
| Synonyms |
Octylphenolpoly(ethyleneglycolether)x |
| IUPAC Name |
2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol |
| Molecular Weight |
625 |
| Molecular Formula |
C33H60O10 |
| Canonical SMILES |
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCO |
| InChI |
InChI=1S/C16H26O2/c1-15(2,3)12-16(4,5)13-6-8-14(9-7-13)18-11-10-17/h6-9,17H,10-12H2,1-5H3 |
| InChI Key |
JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Boiling Point |
250 °C (lit.) |
| Melting Point |
44-46 °C |
| Flash Point |
535 °F |
| Density |
1.06 g/mL at 20 °C |
| Solubility |
Soluble in water |
| Complexity |
232 |
| Covalently-Bonded Unit Count |
1 |
| Critical Micelle Concentration |
(H₂O) ~ 0.23 mM |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
250.193280068 |
| Heavy Atom Count |
18 |
| Hydrogen Bond Acceptor Count |
2 |
| Hydrogen Bond Donor Count |
1 |
| Isomeric SMILES |
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCO |
| Monoisotopic Mass |
250.193280068 |
| pH |
6.5-8.5 (25 °C) |
| Physical State |
Liquid |
| Rotatable Bond Count |
6 |
| Storage Conditions |
Room temperature |
| Topological Polar Surface Area |
29.5 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.