| Catalog Number |
ACM139899 |
| CAS |
139-89-9 |
| Synonyms |
Glycine, N-(2-(bis(carboxymethyl)amino)ethyl)-N-(2-hydroxyethyl)-, trisodium salt |
| IUPAC Name |
Trisodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxyethyl)amino]acetate |
| Molecular Weight |
344.20 |
| Molecular Formula |
C10H15N2Na3O7 |
| Canonical SMILES |
C(CN(CC(=O)[O-])CC(=O)[O-])N(CCO)CC(=O)[O-].[Na+].[Na+].[Na+] |
| InChI |
WHNXAQZPEBNFBC-UHFFFAOYSA-K |
| InChI Key |
InChI=1S/C10H18N2O7.3Na/c13-4-3-11(5-8(14)15)1-2-12(6-9(16)17)7-10(18)19;;;/h13H,1-7H2,(H,14,15)(H,16,17)(H,18,19);;;/q;3*+1/p-3 |
| Melting Point |
288 °C |
| Flash Point |
300°C |
| Purity |
98%+ |
| Density |
1.285g/ml |
| Appearance |
White crystalline powder |
| Complexity |
289 |
| Covalently-Bonded Unit Count |
4 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
344.05723367 |
| Heavy Atom Count |
22 |
| Hydrogen Bond Acceptor Count |
9 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
344.05723367 |
| Physical State |
Solid |
| Rotatable Bond Count |
8 |
| Storage Conditions |
Store at RT. |
| Topological Polar Surface Area |
147 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.