| Catalog Number |
ACM1923702-1 |
| CAS |
1923-70-2 |
| Structure |  |
| Synonyms |
Tetra-n-butylammonium perchlorate |
| IUPAC Name |
Tetrabutylazanium;perchlorate |
| Molecular Weight |
341.91 |
| Molecular Formula |
C16H36ClNO4 |
| Canonical SMILES |
CCCC[N+](CCCC)(CCCC)CCCC.[O-]Cl(=O)(=O)=O |
| InChI |
InChI=1S/C16H36N.ClHO4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5/h5-16H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChI Key |
KBLZDCFTQSIIOH-UHFFFAOYSA-M |
| Melting Point |
211-215 °C |
| Purity |
98% |
| Solubility |
Soluble in acetonitrile and ethanol; very slightly soluble in water |
| Appearance |
Off-white solid |
| Storage |
Store under inert gas |
| Complexity |
212 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
0 |
| EC Number |
217-655-5 |
| Exact Mass |
341.2332863 |
| Heavy Atom Count |
22 |
| Hydrogen Bond Acceptor Count |
4 |
| Hydrogen Bond Donor Count |
0 |
| Isomeric SMILES |
CCCC[N+](CCCC)(CCCC)CCCC.[O-]Cl(=O)(=O)=O |
| MDL Number |
MFCD00038722 |
| Monoisotopic Mass |
341.2332863 |
| Physical State |
Crystalline powder |
| Rotatable Bond Count |
12 |
| Topological Polar Surface Area |
74.3 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.