| Catalog Number |
ACM6009989 |
| CAS |
6009-98-9 |
| Structure |  |
| Synonyms |
Taurochenodeoxycholic acid sodium salt |
| IUPAC Name |
Sodium;2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate |
| Molecular Weight |
521.7 |
| Molecular Formula |
C26H44NNaO6S |
| Canonical SMILES |
CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C.[Na+] |
| InChI |
InChI=1S/C26H45NO6S.Na/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29;/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33);/q;+1/p-1/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-;/m1./s1 |
| InChI Key |
IYPNVUSIMGAJFC-HLEJRKHJSA-M |
| Melting Point |
165-175 °C |
| Purity |
97% |
| Complexity |
864 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
10 |
| Exact Mass |
521.27870358 |
| Heavy Atom Count |
35 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
C[C@H](CCC(=O)NCCS(=O)(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C.[Na+] |
| Monoisotopic Mass |
521.27870358 |
| Rotatable Bond Count |
7 |
| Topological Polar Surface Area |
135 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.