| Catalog Number |
ACM29923317-2 |
| CAS |
29923-31-7 |
| Structure |  |
| Synonyms |
L-Glutamic acid, N-(1-oxododecyl)-, disodium salt |
| IUPAC Name |
disodium;(2S)-2-(dodecanoylamino)pentanedioate |
| Molecular Weight |
351.41 |
| Molecular Formula |
C17H30NO5Na |
| Canonical SMILES |
CCCCCCCCCCCC(=O)NC(CCC(=O)O)C(=O)[O-].[Na+] |
| InChI |
InChI=1S/C17H31NO5.2Na/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-14(17(22)23)12-13-16(20)21;;/h14H,2-13H2,1H3,(H,18,19)(H,20,21)(H,22,23);;/q;2*+1/p-2/t14-;;/m0../s1 |
| InChI Key |
HWUINYGRRJTXGE-UTLKBRERSA-L |
| Flash Point |
282.6°C |
| Purity |
95%+ |
| Density |
1.28 g/cm³ at 23° C |
| Appearance |
Liquid |
| Complexity |
346 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
1 |
| EC Number |
249-958-3 |
| Exact Mass |
373.18411159 |
| Heavy Atom Count |
25 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
1 |
| Isomeric SMILES |
CCCCCCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Monoisotopic Mass |
373.18411159 |
| Physical State |
Solid |
| Rotatable Bond Count |
13 |
| Storage Conditions |
Room temperature |
| Topological Polar Surface Area |
109 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.