| Catalog Number |
ACM16564435 |
| CAS |
16564-43-5 |
| Structure |  |
| Synonyms |
Glycochenodeoxycholic acid sodium salt |
| IUPAC Name |
Sodium;2-[[(4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetate |
| Molecular Weight |
471.6 |
| Molecular Formula |
C26H42NNaO5 |
| Canonical SMILES |
CC(CCC(=O)NCC(=O)[O-])C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C.[Na+] |
| InChI |
InChI=1S/C26H43NO5.Na/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29;/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32);/q;+1/p-1/t15-,16+,17-,18-,19+,20+,21-,24+,25+,26-;/m1./s1 |
| InChI Key |
AAYACJGHNRIFCT-YRJJIGPTSA-M |
| Melting Point |
160-170 °C |
| Purity |
97%+ |
| Complexity |
734 |
| Covalently-Bonded Unit Count |
2 |
| Defined Atom Stereocenter Count |
10 |
| Exact Mass |
471.29606772 |
| Heavy Atom Count |
33 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
C[C@H](CCC(=O)NCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C.[Na+] |
| Monoisotopic Mass |
471.29606772 |
| Rotatable Bond Count |
6 |
| Topological Polar Surface Area |
110 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.