| Catalog Number |
ACM206986870 |
| CAS |
206986-87-0 |
| Structure |  |
| Synonyms |
3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid sodium salt |
| IUPAC Name |
sodium;(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| Molecular Weight |
430.55 (anhydrous basis) |
| Molecular Formula |
C24H39NaO5·xH₂O |
| Canonical SMILES |
CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.[Na+] |
| InChI |
InChI=1S/C24H40O5.Na/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26;/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29);/q;+1/p-1/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-;/m1./s1 |
| InChI Key |
NRHMKIHPTBHXPF-TUJRSCDTSA-M |
| Purity |
99% |
| Solubility |
Soluble in water |
| Appearance |
White crystal or colorless powder |
| Complexity |
643 |
| Covalently-Bonded Unit Count |
3 |
| Defined Atom Stereocenter Count |
11 |
| EC Number |
206-643-5 |
| Exact Mass |
430.26951862 |
| Heavy Atom Count |
30 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C.[Na+] |
| MDL Number |
MFCD00150749 |
| Monoisotopic Mass |
430.26951862 |
| Physical State |
Powder |
| Rotatable Bond Count |
4 |
| Topological Polar Surface Area |
101 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.