| Catalog Number |
ACM361091 |
| CAS |
361-09-1 |
| Synonyms |
3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid, monosodium salt |
| IUPAC Name |
sodium;(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| Molecular Weight |
430.6 |
| Molecular Formula |
C24H39O5Na |
| Canonical SMILES |
CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.[Na+] |
| InChI |
InChI=1S/C24H40O5.Na/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26;/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29);/q;+1/p-1/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-;/m1./s1 |
| InChI Key |
NRHMKIHPTBHXPF-TUJRSCDTSA-M |
| Melting Point |
292 °C |
| Purity |
≥98% |
| Solubility |
≥40% (in water at 20 °C) |
| Appearance |
White powder |
| Complexity |
643 |
| Covalently-Bonded Unit Count |
2 |
| Critical Micelle Concentration |
~ 9.5 mM |
| Defined Atom Stereocenter Count |
11 |
| EC Number |
206-643-5 |
| Exact Mass |
430.26951862 |
| Heavy Atom Count |
30 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C.[Na+] |
| Monoisotopic Mass |
430.26951862 |
| pH |
5-8 (1% solution in water) |
| Physical State |
Powder |
| Rotatable Bond Count |
4 |
| Shipping |
ambient temperature |
| Storage Conditions |
Ambient temperature |
| Topological Polar Surface Area |
101 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.