| Catalog Number |
ACM1448368-1 |
| CAS |
1448-36-8 |
| Structure |  |
| Synonyms |
Cholic acid methyl ester |
| IUPAC Name |
methyl (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| Molecular Weight |
422.61 |
| Molecular Formula |
C25H42O5 |
| Canonical SMILES |
CC(CCC(=O)OC)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |
| InChI |
InChI=1S/C25H42O5/c1-14(5-8-22(29)30-4)17-6-7-18-23-19(13-21(28)25(17,18)3)24(2)10-9-16(26)11-15(24)12-20(23)27/h14-21,23,26-28H,5-13H2,1-4H3/t14-,15+,16-,17-,18+,19+,20-,21+,23+,24+,25-/m1/s1 |
| InChI Key |
DLYVTEULDNMQAR-SRNOMOOLSA-N |
| Boiling Point |
541.6±50.0 °C (Predicted) |
| Melting Point |
155-156 °C |
| Purity |
97% |
| Density |
1.141±0.06 g/cm³ (Predicted) |
| Solubility |
Insoluble in water, soluble in medium polarity organic solvents. |
| Appearance |
Off-white solid |
| Storage |
Solid |
| Complexity |
652 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
11 |
| EC Number |
215-903-7 |
| Exact Mass |
422.30322444 |
| Heavy Atom Count |
30 |
| Hydrogen Bond Acceptor Count |
5 |
| Hydrogen Bond Donor Count |
3 |
| Isomeric SMILES |
C[C@H](CCC(=O)OC)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C |
| MDL Number |
MFCD00064934 |
| Monoisotopic Mass |
422.30322444 |
| Physical State |
Freezer |
| Rotatable Bond Count |
5 |
| Storage Conditions |
Ambient temperature |
| Topological Polar Surface Area |
87 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.