| Catalog Number |
ACM367931-1 |
| CAS |
367-93-1 |
| Structure |  |
| Synonyms |
1-Methylethyl1-thio-beta-d-galactopyranosid |
| IUPAC Name |
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-propan-2-ylsulfanyloxane-3,4,5-triol |
| Molecular Weight |
238.3 |
| Molecular Formula |
C9H18O5S |
| Canonical SMILES |
CC(C)S[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
| InChI |
InChI=1S/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5-,6+,7+,8-,9+/m1/s1 |
| InChI Key |
BPHPUYQFMNQIOC-NXRLNHOXSA-N |
| Melting Point |
105 °C |
| Purity |
98% |
| Density |
1.33 g/ml |
| Appearance |
White powder |
| Complexity |
201 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
5 |
| Exact Mass |
238.08749484 |
| Heavy Atom Count |
15 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CC(C)S[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
| Monoisotopic Mass |
238.08749484 |
| Physical State |
Crystalline powder |
| Rotatable Bond Count |
3 |
| Topological Polar Surface Area |
115 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.