| Catalog Number |
ACM78617126 |
| CAS |
78617-12-6 |
| Structure |  |
| Synonyms |
N-Heptyl β-d-glucopyranoside |
| IUPAC Name |
(2R,3R,4S,5S,6R)-2-(Heptyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| Molecular Weight |
278.34 |
| Molecular Formula |
C13H26O6 |
| Canonical SMILES |
CCCCCCCOC1C(C(C(C(O1)CO)O)O)O |
| InChI |
InChI=1S/C13H26O6/c1-2-3-4-5-6-7-18-13-12(17)11(16)10(15)9(8-14)19-13/h9-17H,2-8H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChI Key |
NIDYWHLDTIVRJT-UJPOAAIJSA-N |
| Boiling Point |
443.1ºC at 760 mmHg |
| Melting Point |
74-75 °C |
| Flash Point |
221.8ºC |
| Purity |
98%+ |
| Density |
1.21g/cm³ |
| Complexity |
237 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
5 |
| Exact Mass |
278.17293854 |
| Heavy Atom Count |
19 |
| Hydrogen Bond Acceptor Count |
6 |
| Hydrogen Bond Donor Count |
4 |
| Isomeric SMILES |
CCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Monoisotopic Mass |
278.17293854 |
| Physical State |
Powder |
| Rotatable Bond Count |
8 |
| Topological Polar Surface Area |
99.4 Ų |
Our products and services are for research use only and cannot be used for any clinical purposes.