What is the molecular formula of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
The molecular formula is C48H97NO8P+.
What is the molecular weight of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
The molecular weight is 847.3g/mol.
How many hydrogen bond acceptor counts are there in 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
There are 8 hydrogen bond acceptor counts.
What is the XLogP3 value of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
The XLogP3 value is 15.9.
What is the exact mass of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
The exact mass is 846.69518105.
What is the InChIKey of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
The InChIKey is UKDDQGWMHWQMBI-UHFFFAOYSA-O.
What are some synonyms for 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
Some synonyms include diphytanoyl lecithin, DPhyPC, and 1,2-diphytanoylphosphatidylcholine.
How many rotatable bond counts are there in 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
There are 40 rotatable bond counts.
What is the Canonical SMILES of 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C
How many defined atom stereocenter counts are there in 1,2-Diphytanoyl-sn-glycero-3-phosphocholine?
There are 0 defined atom stereocenter counts.