What is the molecular formula of 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
The molecular formula is C44H84NO8P.
What is the molecular weight of 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
The molecular weight is 786.1 g/mol.
How many hydrogen bond acceptors does 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine have?
It has 8 hydrogen bond acceptors.
How many rotatable bonds does 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine have?
It has 42 rotatable bonds.
What is the Canonical SMILES for 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
CCCCCCCCCC=CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
What is the IUPAC name for 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
[(2R)-2,3-bis[[(Z)-octadec-6-enoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate
What are some of the Depositor-Supplied Synonyms for 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
Dipetroselenoyl-L-alpha-glycerophosphorylcholine, PC(18:1(6Z)/18:1(6Z)), L-Dipetroselinoyl lecithin, etc.
What is the InChIKey for 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine?
KLJBLQFSKZACGJ-MMKOEKFTSA-N
How many defined bond stereocenter counts does 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine have?
It has 2 defined bond stereocenter counts.
What is the complexity of 1,2-Dipetroselenoyl-sn-glycero-3-phosphocholine as per Computed Properties?
The complexity is 972.