Vaccine Lab / Alfa Chemistry
1,2-Dipalmitoyl-3-dimethylammonium-propane

Our customer services representatives are available 24 hours a day, from Monday to Sunday.

CONTACT US

1,2-Dipalmitoyl-3-dimethylammonium-propane

Catalog Number ACM96326748
CAS 96326-74-8
Synonyms 16:0 DAP
IUPAC Name [3-(Dimethylamino)-2-hexadecanoyloxypropyl] hexadecanoate
Molecular Weight 596
Molecular Formula C37H73NO4
Canonical SMILES CCCCCCCCCCCCCCCC(=O)OCC(CN(C)C)OC(=O)CCCCCCCCCCCCCCC
InChI InChI=1S/C37H73NO4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36(39)41-34-35(33-38(3)4)42-37(40)32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h35H,5-34H2,1-4H3
InChI Key ALRIWCIIGVAXHV-UHFFFAOYSA-N
Purity 99%+
Complexity 580
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 595.55395981
Heavy Atom Count 42
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 595.55395981
Physical State Powder
Rotatable Bond Count 35
Storage Conditions -20 °C
Topological Polar Surface Area 55.8 Ų
Knowledge & Learning Case Study Q&A

What is the official name of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The official name of 1,2-Dipalmitoyl-3-dimethylammonium-propane is Hexadecanoic acid 1-dimethylaminomethyl-2-hexadecanoyloxy-ethyl ester.

What is the molecular formula of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The molecular formula of 1,2-Dipalmitoyl-3-dimethylammonium-propane is C37H73NO4.

What is the molecular weight of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The molecular weight of 1,2-Dipalmitoyl-3-dimethylammonium-propane is 596.0g/mol.

What is the exact mass of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The exact mass of 1,2-Dipalmitoyl-3-dimethylammonium-propane is 595.55395981.

How many hydrogen bond acceptors does 1,2-Dipalmitoyl-3-dimethylammonium-propane have?

1,2-Dipalmitoyl-3-dimethylammonium-propane has 5 hydrogen bond acceptors.

How many rotatable bond counts does 1,2-Dipalmitoyl-3-dimethylammonium-propane have?

1,2-Dipalmitoyl-3-dimethylammonium-propane has 35 rotatable bond counts.

What is the Canonical SMILES representation of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The Canonical SMILES representation of 1,2-Dipalmitoyl-3-dimethylammonium-propane is CCCCCCCCCCCCCCCC(=O)OCC(CN(C)C)OC(=O)CCCCCCCCCCCCCCC.

What is the InChIKey of 1,2-Dipalmitoyl-3-dimethylammonium-propane?

The InChIKey of 1,2-Dipalmitoyl-3-dimethylammonium-propane is ALRIWCIIGVAXHV-UHFFFAOYSA-N.

What are some other synonyms for 1,2-Dipalmitoyl-3-dimethylammonium-propane?

Some other synonyms for 1,2-Dipalmitoyl-3-dimethylammonium-propane include 16:0 DAP, BP-28229, and SCHEMBL4435412.

How many heavy atoms does 1,2-Dipalmitoyl-3-dimethylammonium-propane contain?

1,2-Dipalmitoyl-3-dimethylammonium-propane contains 42 heavy atoms.

Our products and services are for research use only and cannot be used for any clinical purposes.

Online Inquiry
Verification code