CAS 322647-40-5 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt

What is the CAS number of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The CAS number is 67254-28-8.

How many heavy atoms are present in the molecular structure of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

There are 54 heavy atoms.

How many rotatable bonds are present in the molecular structure of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

There are 42 rotatable bonds.

What is the molecular weight of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The molecular weight is 797.0 g/mol.

What is the IUPAC name of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The IUPAC name is sodium;[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 2,3-dihydroxypropyl phosphate.

Can you provide some synonyms for 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

Some synonyms include DOPG Na, l-, DOPG-Na, r-, and Dioleoylphosphatidylglycerol Sodium Salt.

What is the computed property for hydrogen bond acceptor count in the molecular structure of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The hydrogen bond acceptor count is 10.

What are some MeSH entry terms related to 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

MeSH entry terms include 1,2-dioleoyl-sn-glycero-3-phosphoglycerol and di-C18-1(C)-PG.

What is the exact mass of 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The exact mass is 796.52302996.

What is the UNII code for 1,2-Dioleoyl-sn-glycero-3-phospho-rac-(1-glycerol) sodium salt?

The UNII code is T40U11PG20.

Catalog Number	ACM322647405
CAS	322647-40-5
Synonyms	[(2R)-2,3-Bis[[(E)-octadec-9-enoyl]oxy]propyl] 2,3-dihydroxypropyl phosphate
IUPAC Name	Sodium;[(2R)-2,3-bis[[(E)-octadec-9-enoyl]oxy]propyl] 2,3-dihydroxypropyl phosphate
Molecular Weight	797
Molecular Formula	C42H78NaO10P
Canonical SMILES	CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC(CO)O)OC(=O)CCCCCCCC=CCCCCCCCC.[Na+]
InChI	InChI=1S/C42H79O10P.Na/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(45)49-37-40(38-51-53(47,48)50-36-39(44)35-43)52-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20,39-40,43-44H,3-16,21-38H2,1-2H3,(H,47,48);/q;+1/p-1/b19-17+,20-18+;/t39,40-;/m1./s1
InChI Key	IUVFCFQZFCOKRC-PDSLQGCUSA-M
Purity	99%+
Complexity	948
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	1
Exact Mass	796.52302996
Heavy Atom Count	54
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	2
Isomeric SMILES	CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC(CO)O)OC(=O)CCCCCCC/C=C/CCCCCCCC.[Na+]
Monoisotopic Mass	796.52302996
Physical State	Powder
Rotatable Bond Count	42
Storage Conditions	-20 °C
Topological Polar Surface Area	152 Å²