What is the molecular formula of 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
The molecular formula is C36H68NO8P.
What is the exact mass of 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
The exact mass is 673.46825513 g/mol.
How many hydrogen bond acceptors does 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine have?
It has 8 hydrogen bond acceptors.
What is the Canonical SMILES of 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
CCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCC
How many rotatable bonds does 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine have?
It has 34 rotatable bonds.
What is the IUPAC Name of 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
It is [(2R)-2,3-bis[[(Z)-tetradec-9-enoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
What is the InChIKey of 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
The InChIKey is AVCZHZMYOZARRJ-JWLMTKEBSA-N.
How many heavy atoms are present in 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
There are 46 heavy atoms.
What is the Complexity value for 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
The complexity value is 847.
What is a common synonym for 1,2-Dimyristoleoyl-sn-glycero-3-phosphocholine?
A common synonym is Dimyristoleoyl-L-alpha-glycerophosphorylcholine.