What is the molecular formula of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
The molecular formula is C25H50NO8P.
What is the exact mass of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
The exact mass is 523.32740455.
How many hydrogen bond acceptor counts are there in 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
There are 9 hydrogen bond acceptor counts.
What is the Canonical SMILES representation of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
CCCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCCC
What is the IUPAC Name of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-decanoyloxypropyl] decanoate
How many heavy atoms are there in 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
There are 35 heavy atoms.
Is 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine chiral?
Yes, it has 1 defined atom stereocenter count, making it chiral.
What is the XLogP3 value of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
The XLogP3 value is 3.8.
What is the Covalently-Bonded Unit Count of 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
The Covalently-Bonded Unit Count is 1.
What are some other names or synonyms for 1,2-Didecanoyl-sn-glycero-3-phosphoethanolamine?
Some synonyms include PE(10:0/10:0), PEX, LMGP02010101, NS00073966, and more.