2-(2,6,8-Trimethylnonan-4-yloxy)ethanol
| Catalog Number |
ACM60828786 |
| CAS |
60828-78-6 |
| Synonyms |
Trimethylnonylpolyethylene glycol |
| Molecular Weight |
230.39 |
| Molecular Formula |
C14H30O2 |
| Canonical SMILES |
CC(C)CC(C)CC(CC(C)C)OCCO |
| InChI |
InChI=1S/C14H30O2/c1-11(2)8-13(5)10-14(9-12(3)4)16-7-6-15/h11-15H,6-10H2,1-5H3 |
| InChI Key |
VKKFWRYCMZBXIG-UHFFFAOYSA-N |
| Purity |
90% |
| Complexity |
155 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
230.224580195 |
| Heavy Atom Count |
16 |
| Hydrogen Bond Acceptor Count |
2 |
| Hydrogen Bond Donor Count |
1 |
| Monoisotopic Mass |
230.224580195 |
| Physical State |
Liquid |
| Rotatable Bond Count |
9 |
| Topological Polar Surface Area |
29.5 Ų |
Knowledge & Learning
Case Study
Q&A
Our products and services are for research use only and cannot be used for any clinical purposes.