1,2-Didecanoyl-sn-glycero-3-phosphocholine

Catalog Number	ACM3436440
CAS	3436-44-0
Structure
Synonyms	10:0 PC
IUPAC Name	[(2R)-2,3-Di(decanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate
Molecular Weight	565.7
Molecular Formula	C28H56NO8P
Canonical SMILES	CCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC
InChI	InChI=1S/C28H56NO8P/c1-6-8-10-12-14-16-18-20-27(30)34-24-26(25-36-38(32,33)35-23-22-29(3,4)5)37-28(31)21-19-17-15-13-11-9-7-2/h26H,6-25H2,1-5H3/t26-/m1/s1
InChI Key	MLKLDGSYMHFAOC-AREMUKBSSA-N
Purity	99%+
Complexity	645
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	565.37435474
Heavy Atom Count	38
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Isomeric SMILES	CCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC
Monoisotopic Mass	565.37435474
Physical State	Liquid
Rotatable Bond Count	28
Storage Conditions	-20 °C
Topological Polar Surface Area	111 Ų
WGK Germany	3

Knowledge & Learning Case Study Q&A

What is the IUPAC name of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The IUPAC name of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is [(2R)-2,3-di(decanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate.

What is the molecular formula of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The molecular formula of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is C28H56NO8P.

What is the molecular weight of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The molecular weight of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is 565.7g/mol.

What is the CAS number of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The CAS number of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is 3436-44-0.

How many hydrogen bond acceptors does 1,2-Didecanoyl-sn-glycero-3-phosphocholine have?

1,2-Didecanoyl-sn-glycero-3-phosphocholine has 8 hydrogen bond acceptors.

What is the Canonical SMILES representation of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The Canonical SMILES representation of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is CCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC.

What is the InChIKey of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The InChIKey of 1,2-Didecanoyl-sn-glycero-3-phosphocholine is MLKLDGSYMHFAOC-AREMUKBSSA-N.

What are some of the synonyms of 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

Some synonyms of 1,2-Didecanoyl-sn-glycero-3-phosphocholine include Didecanoyllecithin, L-Dicapryllecithin, and 1,2-Didecanoyl PC.

How many rotatable bonds does 1,2-Didecanoyl-sn-glycero-3-phosphocholine have?

1,2-Didecanoyl-sn-glycero-3-phosphocholine has 28 rotatable bonds.

What is the UNII number assigned to 1,2-Didecanoyl-sn-glycero-3-phosphocholine?

The UNII number assigned to 1,2-Didecanoyl-sn-glycero-3-phosphocholine is 66BXC7TK3J.

Our products and services are for research use only and cannot be used for any clinical purposes.

Online Inquiry

1,2-Didecanoyl-sn-glycero-3-phosphocholine (3436-44-0)

Send A Message