Our customer services representatives are available 24 hours a day, from Monday to Sunday.
CONTACT US| Catalog Number | ACM56816003 |
| CAS | 56816-00-3 |
| Synonyms | 16:1 (Delta9-trans) PC |
| IUPAC Name | [(2R)-2,3-Bis[[(E)-hexadec-9-enoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| Molecular Weight | 730 |
| Molecular Formula | C40H76NO8P |
| Canonical SMILES | CCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C40H76NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-39(42)46-36-38(37-48-50(44,45)47-35-34-41(3,4)5)49-40(43)33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h16-19,38H,6-15,20-37H2,1-5H3/b18-16+,19-17+/t38-/m1/s1 |
| InChI Key | GPWHCUUIQMGELX-SGZUMCNSSA-N |
| Purity | 99%+ |
| Complexity | 909 |
| Covalently-Bonded Unit Count | 1 |
| Defined Atom Stereocenter Count | 1 |
| Exact Mass | 729.53085538 |
| Heavy Atom Count | 50 |
| Hydrogen Bond Acceptor Count | 8 |
| Hydrogen Bond Donor Count | 0 |
| Isomeric SMILES | CCCCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/CCCCCC |
| Monoisotopic Mass | 729.53085538 |
| Physical State | Powder |
| Rotatable Bond Count | 38 |
| Storage Conditions | -20 °C |
| Topological Polar Surface Area | 111 Ų |
What is the IUPAC Name of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine "1,2-di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine"?
The IUPAC Name of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is [(2R)-2,3-bis[[(E)-hexadec-9-enoyl]oxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
What is the molecular formula of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
The molecular formula of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is C40H76NO8P.
What is the molecular weight of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
The molecular weight of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is 730.0g/mol.
What is the exact mass of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
The exact mass of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is 729.53085538.
How many hydrogen bond acceptors does 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine have?
1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine has 8 hydrogen bond acceptors.
How many isotope atom count does 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine have?
1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine has 0 isotope atom count.
What is the Canonical SMILES of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
The Canonical SMILES of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is CCCCCC=CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCC.
What is the XLogP3 value of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
The XLogP3 value of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine is 11.6.
What are some Depositor-Supplied Synonyms of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine?
Some Depositor-Supplied Synonyms of 1,2-Di-(9E-hexadecenoyl)-sn-glycero-3-phosphocholine are 16:1 (Delta9-Trans) PC, Dipalmitelaidoyl-L-alpha-glycerophosphorylcholine, and LMGP01010682.
Our products and services are for research use only and cannot be used for any clinical purposes.
Alfa Chemistry is a global leader in the vaccine industry. We have the ability to help our customers meet the challenges of various vaccine development processes. Alfa Chemistry believes that partnerships will change the way the world innovates, bringing new technologies.
Interested in our Services & Products? Need detailed information?
Privacy Policy | Cookie Policy | Copyright © 2024 Alfa Chemistry. All rights reserved.